
CAS 956264-14-5
:Ethyl 3-[(5-methyl-3-nitro-1H-pyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxylate
Description:
Ethyl 3-[(5-methyl-3-nitro-1H-pyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxylate is a chemical compound characterized by its complex structure, which includes an ethyl ester group, an oxadiazole ring, and a pyrazole moiety. The presence of the nitro group on the pyrazole ring contributes to its potential reactivity and biological activity. This compound is typically synthesized through multi-step organic reactions, involving the formation of the oxadiazole and subsequent functionalization with the pyrazole derivative. It may exhibit properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and agricultural applications. The specific characteristics, such as melting point, boiling point, and spectral data (NMR, IR, etc.), would depend on the purity and specific conditions under which the compound is handled. As with many nitrogen-containing heterocycles, it may also display interesting pharmacological properties, warranting further investigation for potential therapeutic uses.
Formula:C10H11N5O5
InChI:InChI=1S/C10H11N5O5/c1-3-19-10(16)9-11-7(13-20-9)5-14-6(2)4-8(12-14)15(17)18/h4H,3,5H2,1-2H3
InChI key:InChIKey=LEEVCWLQDAZISW-UHFFFAOYSA-N
SMILES:C(N1N=C(N(=O)=O)C=C1C)C=2N=C(C(OCC)=O)ON2
Synonyms:- 1,2,4-Oxadiazole-5-carboxylic acid, 3-[(5-methyl-3-nitro-1H-pyrazol-1-yl)methyl]-, ethyl ester
- Ethyl 3-[(5-methyl-3-nitro-1H-pyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.