CAS 95630-79-8

rel-(1R,2R,3S,4S)-3-Aminobicyclo[2.2.1]heptane-2-methanol

Description:

Rel-(1R,2R,3S,4S)-3-Aminobicyclo[2.2.1]heptane-2-methanol, with the CAS number 95630-79-8, is a bicyclic organic compound characterized by its unique bicyclo[2.2.1]heptane structure, which consists of a seven-membered ring system. This compound features an amino group and a hydroxymethyl group, contributing to its potential as a chiral building block in organic synthesis. The stereochemistry indicated by the (1R,2R,3S,4S) configuration suggests specific spatial arrangements of its substituents, which can influence its reactivity and interactions with biological systems. The presence of both an amine and an alcohol functional group allows for diverse chemical reactivity, including potential hydrogen bonding and nucleophilic substitution reactions. This compound may be of interest in medicinal chemistry and drug development due to its structural properties and stereochemical complexity, which can affect pharmacological activity. Additionally, its chiral nature may lead to enantioselective synthesis applications in various chemical processes.

Formula: C₈H₁₅NO

InChI: InChI=1/C8H15NO/c9-8-6-2-1-5(3-6)7(8)4-10/h5-8,10H,1-4,9H2/t5-,6+,7-,8+/s2

InChI key: InChIKey=QGMMKSUHQMVLRO-INGVHDAZNA-N

SMILES: C(O)[C@@H]1[C@]2(C[C@@]([C@@H]1N)(CC2)[H])[H]

Synonyms:

• Bicyclo[2.2.1]heptane-2-methanol, 3-amino-, (endo,endo)-
• rel-(1R,2R,3S,4S)-3-Aminobicyclo[2.2.1]heptane-2-methanol
• Bicyclo[2.2.1]heptane-2-methanol, 3-amino-, (1R,2R,3S,4S)-rel-