CAS 956317-36-5: 5-Methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid
Description:5-Methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with a methyl group and a 1,2,3-triazole ring. This compound typically exhibits properties such as moderate solubility in polar solvents and potential biological activity due to the presence of the triazole group, which is known for its role in various pharmacological applications. The triazole ring can participate in hydrogen bonding and coordination with metal ions, making it of interest in coordination chemistry and medicinal chemistry. Additionally, the presence of the carboxylic acid functional group contributes to its acidity and reactivity, allowing for potential derivatization and interaction with other chemical entities. Overall, 5-Methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid is a versatile compound with applications in research and development, particularly in the fields of organic synthesis and drug discovery.
Formula:C10H9N3O2
InChI:InChI=1S/C10H9N3O2/c1-7-2-3-9(8(6-7)10(14)15)13-11-4-5-12-13/h2-6H,1H3,(H,14,15)
InChI key:InChIKey=SRBAGFIYKNQXDV-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(=CC=C1N2N=CC=N2)C
- Synonyms:
- 2-(2H-1,2,3-triazol-2-yl)-5-methylbenzoic acid
- 5-Methyl-2-1,2,3-triazol-2-ylbenzoic acid
- Benzoic acid, 5-methyl-2-(2H-1,2,3-triazol-2-yl)-
- 5-Methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid
