CymitQuimica logo

CAS 956344-34-6

:

4-[5-[bis[2-[(2R)-2-acetamido-3-hydroxy-3-oxo-propyl]sulfanylethyl]amino]-1-methyl-benzimidazol-2-yl]butanoic acid

Description:
The chemical substance known as 4-[5-[bis[2-[(2R)-2-acetamido-3-hydroxy-3-oxo-propyl]sulfanylethyl]amino]-1-methyl-benzimidazol-2-yl]butanoic acid, with the CAS number 956344-34-6, is a complex organic compound characterized by its multi-functional structure. It features a benzimidazole core, which is a bicyclic structure known for its biological activity, particularly in pharmaceuticals. The presence of multiple functional groups, including amine, acetamido, and carboxylic acid moieties, suggests potential for diverse interactions in biological systems. The compound likely exhibits solubility in polar solvents due to its hydrophilic groups, while the hydrophobic regions may influence its membrane permeability. Its potential applications could span medicinal chemistry, particularly in drug design, where such compounds are often explored for their therapeutic properties. The intricate structure indicates that it may engage in various biochemical pathways, making it a candidate for further research in pharmacology and biochemistry.
Formula:C26H37N5O8S2
InChI:InChI=1/C26H37N5O8S2/c1-16(32)27-20(25(36)37)14-40-11-9-31(10-12-41-15-21(26(38)39)28-17(2)33)18-7-8-22-19(13-18)29-23(30(22)3)5-4-6-24(34)35/h7-8,13,20-21H,4-6,9-12,14-15H2,1-3H3,(H,27,32)(H,28,33)(H,34,35)(H,36,37)(H,38,39)/t20-,21-/m0/s1
SMILES:CC(=N[C@@H](CSCCN(CCSC[C@@H](C(=O)O)N=C(C)O)c1ccc2c(c1)nc(CCCC(=O)O)n2C)C(=O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.