CAS 95636-02-5
:(6E)-8-methylnon-6-enoyl chloride
Description:
(6E)-8-Methylnon-6-enoyl chloride, with the CAS number 95636-02-5, is an organic compound characterized by its acyl chloride functional group, which is known for its reactivity and ability to form esters and amides. This compound features a long carbon chain with a double bond, specifically at the sixth position, which contributes to its unsaturation and potential for various chemical reactions. The presence of the methyl group at the eighth position adds to its structural complexity and can influence its physical properties, such as boiling point and solubility. Acyl chlorides like this one are typically used in organic synthesis, particularly in the preparation of other chemical compounds, due to their ability to react with nucleophiles. Additionally, the compound may exhibit characteristics typical of unsaturated fatty acids, including potential applications in the synthesis of pharmaceuticals or agrochemicals. Safety precautions are necessary when handling this compound, as acyl chlorides can be corrosive and may release harmful gases upon reaction with water or moisture.
Formula:C10H17ClO
InChI:InChI=1/C10H17ClO/c1-9(2)7-5-3-4-6-8-10(11)12/h5,7,9H,3-4,6,8H2,1-2H3/b7-5+
Synonyms:- 6-nonenoyl chloride, 8-methyl-, (6E)-
- (6E)-8-Methylnon-6-enoyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
trans-8-Methyl-6-nonenoyl Chloride
CAS:Formula:C10H17ClOPurity:>95.0%(GC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:188.70trans-8-Methyl-6-nonenoyl Chloride
CAS:Formula:C10H17ClOPurity:90%Color and Shape:LiquidMolecular weight:188.6944trans-8-Methyl-6-nonenoyl chloride
CAS:trans-8-Methyl-6-nonenoyl chloridePurity:95%Molecular weight:188.69g/mol



