CymitQuimica logo

CAS 956364-46-8

:

1-ethyl-5-methyl-1H-pyrazol-3-amine

Description:
1-Ethyl-5-methyl-1H-pyrazol-3-amine, with the CAS number 956364-46-8, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl group at the 1-position and a methyl group at the 5-position of the pyrazole ring, along with an amino group at the 3-position, contributing to its reactivity and potential biological activity. The presence of the amino group makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its molecular structure suggests it may exhibit properties such as solubility in polar solvents and the ability to form hydrogen bonds, which can influence its interactions in biological systems. Additionally, compounds of this type may be investigated for their pharmacological properties, including potential applications in medicinal chemistry. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C6H11N3
InChI:InChI=1/C6H11N3/c1-3-9-5(2)4-6(7)8-9/h4H,3H2,1-2H3,(H2,7,8)
InChI key:MAGGRXZKFUAOGD-UHFFFAOYSA-N
SMILES:CCn1c(C)cc(=N)[nH]1
Synonyms:
  • 1H-Pyrazol-3-amine, 1-ethyl-5-methyl-
  • 1-Ethyl-5-methyl-1H-pyrazol-3-amine
Found 5 products.