CymitQuimica logo

CAS 956369-26-9

:

5-(3-Chlorophenoxy)-1,3-dimethyl-1H-pyrazole-4-carbonitrile

Description:
5-(3-Chlorophenoxy)-1,3-dimethyl-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its unique structural features, which include a pyrazole ring substituted with a chlorophenoxy group and a carbonitrile functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. The presence of the chlorophenoxy moiety may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the carbonitrile group can participate in various chemical reactions, enhancing its utility in synthetic applications. The compound's molecular structure suggests potential interactions with biological targets, which could be explored for agrochemical or medicinal purposes. As with many pyrazole derivatives, it may exhibit a range of biological activities, including anti-inflammatory or anti-cancer properties, although specific activity would depend on further empirical studies. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential toxicity or environmental impact.
Formula:C12H10ClN3O
InChI:InChI=1S/C12H10ClN3O/c1-8-11(7-14)12(16(2)15-8)17-10-5-3-4-9(13)6-10/h3-6H,1-2H3
InChI key:InChIKey=XLPJUAWUNSADIM-UHFFFAOYSA-N
SMILES:O(C1=C(C#N)C(C)=NN1C)C2=CC(Cl)=CC=C2
Synonyms:
  • 1H-Pyrazole-4-carbonitrile, 5-(3-chlorophenoxy)-1,3-dimethyl-
  • 5-(3-Chlorophenoxy)-1,3-dimethyl-1H-pyrazole-4-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.