CAS 956371-98-5

2-[(5-Methyl-1H-pyrazol-1-yl)methyl]-4-quinolinecarboxylic acid

Description:

2-[(5-Methyl-1H-pyrazol-1-yl)methyl]-4-quinolinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a quinoline ring and a pyrazole moiety. This compound typically exhibits properties associated with both heterocyclic systems, such as potential biological activity and the ability to form hydrogen bonds due to the presence of carboxylic acid functional groups. The presence of the methyl group on the pyrazole ring may influence its solubility and reactivity. As a carboxylic acid, it can participate in acid-base reactions and may act as a ligand in coordination chemistry. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological relevance of both quinoline and pyrazole derivatives. Additionally, its specific interactions with biological targets could be explored for therapeutic purposes. Overall, this compound represents a class of heterocyclic compounds that are of interest in various fields, including organic synthesis and drug development.

Formula: C₁₅H₁₃N₃O₂

InChI: InChI=1S/C15H13N3O2/c1-10-6-7-16-18(10)9-11-8-13(15(19)20)12-4-2-3-5-14(12)17-11/h2-8H,9H2,1H3,(H,19,20)

InChI key: InChIKey=OKRIIXQGYJWTIZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(CN3C(C)=CC=N3)C1)C=CC=C2

Synonyms:

• 2-[(5-Methyl-1H-pyrazol-1-yl)methyl]-4-quinolinecarboxylic acid
• 4-Quinolinecarboxylic acid, 2-[(5-methyl-1H-pyrazol-1-yl)methyl]-

2-[(5-Methyl-1H-pyrazol-1-yl)methyl]quinoline-4-carboxylic acid

CAS: 956371-98-5

Versatile small molecule scaffold

Formula: C₁₅H₁₃N₃O₂

Purity: Min. 95%

Molecular weight: 267.28 g/mol

Ref: 3D-GNB37198