CAS 956393-75-2

2-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-4-quinolinecarboxylic acid

Description:

2-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-4-quinolinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a quinoline ring and a pyrazole moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in medicinal chemistry due to its unique structural features that may interact with biological targets. The presence of both the pyrazole and quinoline functionalities suggests potential for diverse biological activities, including antimicrobial or anti-inflammatory effects. The carboxylic acid group contributes to its acidity and solubility in polar solvents, which can influence its reactivity and interaction with other molecules. Additionally, the ethyl and methyl substituents on the pyrazole ring may enhance lipophilicity, affecting the compound's pharmacokinetics. Overall, this compound represents a class of heterocyclic compounds that are of interest in drug discovery and development, particularly in the search for novel therapeutic agents.

Formula: C₁₆H₁₅N₃O₂

InChI: InChI=1S/C16H15N3O2/c1-3-19-10(2)13(9-17-19)15-8-12(16(20)21)11-6-4-5-7-14(11)18-15/h4-9H,3H2,1-2H3,(H,20,21)

InChI key: InChIKey=CRNFDTHNNLRGKT-UHFFFAOYSA-N

SMILES: CC1=C(C2=NC3=C(C(C(O)=O)=C2)C=CC=C3)C=NN1CC

Synonyms:

• 4-Quinolinecarboxylic acid, 2-(1-ethyl-5-methyl-1H-pyrazol-4-yl)-
• 2-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-4-quinolinecarboxylic acid