CAS 956393-78-5

[3-[2-[(4-Chlorophenyl)methoxy]phenyl]-1H-pyrazol-1-yl]-2-thienylmethanone

Description:

The chemical substance known as [3-[2-[(4-Chlorophenyl)methoxy]phenyl]-1H-pyrazol-1-yl]-2-thienylmethanone, with the CAS number 956393-78-5, is a complex organic compound characterized by its multi-ring structure and the presence of various functional groups. It features a pyrazole ring, which is a five-membered heterocyclic compound containing two nitrogen atoms, contributing to its potential biological activity. The presence of a thienyl group, derived from thiophene, adds to its aromatic character and may influence its electronic properties. Additionally, the compound includes a chlorophenyl moiety, which can enhance lipophilicity and affect its interaction with biological targets. The methoxy group serves as an electron-donating substituent, potentially modulating the compound's reactivity and solubility. Overall, this substance may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry and drug development. Its structural complexity suggests potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₂₁H₁₅ClN₂O₂S

InChI: InChI=1S/C21H15ClN2O2S/c22-16-9-7-15(8-10-16)14-26-19-5-2-1-4-17(19)18-11-12-24(23-18)21(25)20-6-3-13-27-20/h1-13H,14H2

InChI key: InChIKey=PTIHJZMQAGKWEP-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(Cl)C=C1)C2=C(C=CC=C2)C3=NN(C(=O)C4=CC=CS4)C=C3

Synonyms:

• Methanone, [3-[2-[(4-chlorophenyl)methoxy]phenyl]-1H-pyrazol-1-yl]-2-thienyl-
• [3-[2-[(4-Chlorophenyl)methoxy]phenyl]-1H-pyrazol-1-yl]-2-thienylmethanone