CAS 956394-35-7

1-[(4-Chloro-3-methylphenoxy)methyl]-3,5-dimethyl-1H-pyrazol-4-amine

Description:

1-[(4-Chloro-3-methylphenoxy)methyl]-3,5-dimethyl-1H-pyrazol-4-amine is a chemical compound characterized by its complex structure, which includes a pyrazole ring and a phenoxy group. The presence of a chloro substituent on the aromatic ring contributes to its potential biological activity, while the dimethyl groups on the pyrazole enhance its lipophilicity. This compound is typically classified as an organic amine and may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, this compound represents a specific class of chemical entities that may have applications in various fields, including agrochemicals and pharmaceuticals.

Formula: C₁₃H₁₆ClN₃O

InChI: InChI=1S/C13H16ClN3O/c1-8-6-11(4-5-12(8)14)18-7-17-10(3)13(15)9(2)16-17/h4-6H,7,15H2,1-3H3

InChI key: InChIKey=NXNRBAPYAGRIGW-UHFFFAOYSA-N

SMILES: C(OC1=CC(C)=C(Cl)C=C1)N2C(C)=C(N)C(C)=N2

Synonyms:

• 1-[(4-Chloro-3-methylphenoxy)methyl]-3,5-dimethyl-1H-pyrazol-4-amine
• 1H-Pyrazol-4-amine, 1-[(4-chloro-3-methylphenoxy)methyl]-3,5-dimethyl-

1-(4-Chloro-3-methyl-phenoxymethyl)-3,5-dimethyl-1 H -pyrazol-4-ylamine

CAS: 956394-35-7

Versatile small molecule scaffold

Formula: C₁₃H₁₆ClN₃O

Purity: Min. 95%

Molecular weight: 265.74 g/mol

Ref: 3D-GNB39435