CAS 956394-41-5
:5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazole-1-propanoic acid
Description:
5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazole-1-propanoic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a cyclopropyl group and a trifluoromethyl group. This compound typically exhibits properties associated with both the pyrazole and carboxylic acid functional groups, such as potential acidity and reactivity in various chemical environments. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. Additionally, the cyclopropyl moiety may impart unique steric and electronic properties, affecting the compound's interaction with biological targets. As a result, 5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazole-1-propanoic acid may be explored for its potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups in a given formulation.
Formula:C10H11F3N2O2
InChI:InChI=1S/C10H11F3N2O2/c11-10(12,13)8-5-7(6-1-2-6)15(14-8)4-3-9(16)17/h5-6H,1-4H2,(H,16,17)
InChI key:InChIKey=NSHHJMBUPYGXKS-UHFFFAOYSA-N
SMILES:C(CC(O)=O)N1C(=CC(C(F)(F)F)=N1)C2CC2
Synonyms:- 1H-Pyrazole-1-propanoic acid, 5-cyclopropyl-3-(trifluoromethyl)-
- 5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazole-1-propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.