CAS 956396-73-9

1-[(2,4-Dichlorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide

Description:

1-[(2,4-Dichlorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a carboxylic acid functional group, and a hydrazide moiety. This compound features a dichlorophenoxy group, which contributes to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid and hydrazide functionalities. The presence of the dichlorophenyl group suggests potential applications in agrochemicals or pharmaceuticals, as such substituents are often associated with herbicidal or antimicrobial properties. The compound's hydrazide structure may also indicate reactivity towards various electrophiles, making it a candidate for further chemical modifications. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact. Overall, this compound's unique structural features may offer diverse applications in research and industry, particularly in the fields of medicinal chemistry and agrochemical development.

Formula: C₁₁H₁₀Cl₂N₄O₂

InChI: InChI=1S/C11H10Cl2N4O2/c12-7-1-2-10(8(13)5-7)19-6-17-4-3-9(16-17)11(18)15-14/h1-5H,6,14H2,(H,15,18)

InChI key: InChIKey=CAPPFSBZHFIKIW-UHFFFAOYSA-N

SMILES: C(OC1=C(Cl)C=C(Cl)C=C1)N2N=C(C(NN)=O)C=C2

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 1-[(2,4-dichlorophenoxy)methyl]-, hydrazide
• 1-[(2,4-Dichlorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide
• 1-[(2,4-dichlorophenoxy)methyl]-1H-pyrazole-3-carbohydrazide

1-[(2,4-Dichlorophenoxy)methyl]-1H-pyrazole-3-carbohydrazide

CAS: 956396-73-9

Versatile small molecule scaffold

Formula: C₁₁H₁₀Cl₂N₄O₂

Purity: Min. 95%

Molecular weight: 301.13 g/mol

Ref: 3D-GNB39673