CAS 956439-57-9

1-[(1,3,5-Trimethyl-1H-pyrazol-4-yl)sulfonyl]-4-piperidinecarboxylic acid

Description:

1-[(1,3,5-Trimethyl-1H-pyrazol-4-yl)sulfonyl]-4-piperidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring and a pyrazole moiety. The presence of a sulfonyl group enhances its reactivity and solubility in various solvents. This compound typically exhibits properties such as moderate to high polarity due to the sulfonyl and carboxylic acid functional groups, which can participate in hydrogen bonding. It may also display biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its CAS number, 956439-57-9, allows for easy identification and retrieval of information in chemical databases. Overall, this compound's distinctive features and functional groups contribute to its potential utility in various chemical and biological applications.

Formula: C₁₂H₁₉N₃O₄S

InChI: InChI=1S/C12H19N3O4S/c1-8-11(9(2)14(3)13-8)20(18,19)15-6-4-10(5-7-15)12(16)17/h10H,4-7H2,1-3H3,(H,16,17)

InChI key: InChIKey=KVQQYFCIAYGISQ-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C=1C(C)=NN(C)C1C)N2CCC(C(O)=O)CC2

Synonyms:

• 4-Piperidinecarboxylic acid, 1-[(1,3,5-trimethyl-1H-pyrazol-4-yl)sulfonyl]-
• 1-[(1,3,5-Trimethyl-1H-pyrazol-4-yl)sulfonyl]-4-piperidinecarboxylic acid

1-[(Trimethyl-1H-pyrazol-4-yl)sulfonyl]piperidine-4-carboxylic acid

CAS: 956439-57-9

Versatile small molecule scaffold

Formula: C₁₂H₁₉N₃O₄S

Purity: Min. 95%

Molecular weight: 301.36 g/mol

Ref: 3D-GNB43957