CymitQuimica logo

CAS 956440-77-0

:

Methyl 1-[[(4-amino-5-ethyl-4H-1,2,4-triazol-3-yl)thio]methyl]-1H-pyrazole-3-carboxylate

Description:
Methyl 1-[[(4-amino-5-ethyl-4H-1,2,4-triazol-3-yl)thio]methyl]-1H-pyrazole-3-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrazole ring and a triazole moiety. This compound features a methyl ester functional group, contributing to its solubility and reactivity. The presence of an amino group and a thioether linkage enhances its potential for biological activity, making it of interest in pharmaceutical research, particularly in the development of agrochemicals or medicinal agents. The molecular structure suggests that it may exhibit properties such as antimicrobial or antifungal activity, although specific biological effects would depend on further empirical studies. Additionally, the compound's stability, solubility in various solvents, and reactivity with other chemical species would be important characteristics to consider in practical applications. As with many synthetic organic compounds, safety data, including toxicity and environmental impact, should be reviewed before use.
Formula:C10H14N6O2S
InChI:InChI=1S/C10H14N6O2S/c1-3-8-12-13-10(16(8)11)19-6-15-5-4-7(14-15)9(17)18-2/h4-5H,3,6,11H2,1-2H3
InChI key:InChIKey=QMFDZGCKXKMBEQ-UHFFFAOYSA-N
SMILES:S(CN1N=C(C(OC)=O)C=C1)C=2N(N)C(CC)=NN2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.