CAS 956440-85-0

1-[(4-Bromophenyl)methyl]-4-chloro-1H-pyrazol-3-amine

Description:

1-[(4-Bromophenyl)methyl]-4-chloro-1H-pyrazol-3-amine is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a bromophenyl group and a chloro group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine and halogen substituents. The bromophenyl moiety may impart specific electronic and steric effects, influencing its biological activity and interactions. As a pyrazole derivative, it may exhibit pharmacological properties, making it of interest in medicinal chemistry. The presence of the chloro group can enhance lipophilicity and affect the compound's overall stability and reactivity. Additionally, the compound's molecular weight and structural features suggest potential applications in drug development or as a chemical intermediate. Safety and handling precautions should be observed, as with any chemical substance, particularly those containing halogens and amines, which may pose health risks.

Formula: C₁₀H₉BrClN₃

InChI: InChI=1S/C10H9BrClN3/c11-8-3-1-7(2-4-8)5-15-6-9(12)10(13)14-15/h1-4,6H,5H2,(H2,13,14)

InChI key: InChIKey=QZWODEPNWNACLC-UHFFFAOYSA-N

SMILES: C(N1C=C(Cl)C(N)=N1)C2=CC=C(Br)C=C2

Synonyms:

• 1-[(4-Bromophenyl)methyl]-4-chloro-1H-pyrazol-3-amine
• 1H-Pyrazol-3-amine, 1-[(4-bromophenyl)methyl]-4-chloro-

1-[(4-Bromophenyl)methyl]-4-chloro-1H-pyrazol-3-amine

CAS: 956440-85-0

Versatile small molecule scaffold

Formula: C₁₀H₉BrClN₃

Purity: Min. 95%

Molecular weight: 286.55 g/mol

Ref: 3D-GNB44085