CAS 95648-12-7

potassium [4-(oxiran-2-ylmethoxy)-1-naphthyl] sulfate

Description:

Potassium [4-(oxiran-2-ylmethoxy)-1-naphthyl] sulfate, identified by its CAS number 95648-12-7, is a chemical compound that features a naphthalene ring substituted with an epoxide group and a sulfate moiety. This compound is characterized by its potential applications in various fields, including organic synthesis and materials science, due to the presence of the reactive epoxide group, which can participate in further chemical reactions. The sulfate group contributes to its solubility in polar solvents, making it useful in formulations where solubility is a key factor. Additionally, the structure suggests that it may exhibit interesting biological activities, although specific biological properties would require further investigation. The compound's stability, reactivity, and potential toxicity would also depend on the conditions under which it is handled. As with any chemical substance, proper safety measures should be observed when working with it, including the use of personal protective equipment and adherence to relevant safety guidelines.

Formula: C₁₃H₁₁KO₆S

InChI: InChI=1/C13H12O6S.K/c14-20(15,16)19-13-6-5-12(18-8-9-7-17-9)10-3-1-2-4-11(10)13;/h1-6,9H,7-8H2,(H,14,15,16);/q;+1/p-1

SMILES: c1ccc2c(c1)c(ccc2OS(=O)(=O)O)OCC1CO1.K