CymitQuimica logo

CAS 956485-62-4

:

tert-butyl N-(1H-pyrrolo[2,3-b]pyridin-4-ylmethyl)carbamate

Description:
Tert-butyl N-(1H-pyrrolo[2,3-b]pyridin-4-ylmethyl)carbamate is a chemical compound characterized by its unique structure, which includes a tert-butyl group and a pyrrolo[2,3-b]pyridine moiety. This compound typically exhibits properties associated with carbamates, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbamate functional group. The pyrrolo[2,3-b]pyridine structure may contribute to biological activity, making it of interest in medicinal chemistry and drug development. The compound's molecular interactions can be influenced by the tert-butyl group, which can enhance lipophilicity and affect its pharmacokinetic properties. Additionally, the presence of the nitrogen atom in the pyridine ring may participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the context of its potential applications in pharmaceuticals or agrochemicals.
Formula:C13H17N3O2
InChI:InChI=1/C13H17N3O2/c1-13(2,3)18-12(17)16-8-9-4-6-14-11-10(9)5-7-15-11/h4-7H,8H2,1-3H3,(H,14,15)(H,16,17)
SMILES:CC(C)(C)OC(=NCc1ccnc2c1cc[nH]2)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.