
CAS 95650-42-3
:L-Pyroglutamic acid
Description:
L-Pyroglutamic acid, also known as 5-oxoproline, is a cyclic derivative of the amino acid glutamic acid. It is characterized by its five-membered lactam structure, which contributes to its unique properties. This compound is a non-proteinogenic amino acid and plays a role in various biochemical processes, including the synthesis of glutathione, an important antioxidant in the body. L-Pyroglutamic acid is soluble in water and exhibits a slightly acidic nature due to the presence of a carboxylic acid group. It is often found in biological systems and can be involved in metabolic pathways related to amino acid metabolism. Additionally, it has been studied for its potential neuroprotective effects and its role in cognitive function. In terms of safety, it is generally considered to have low toxicity, but like any chemical, it should be handled with care in laboratory settings. Its applications extend to pharmaceuticals and nutritional supplements, where it may be used to support cognitive health and metabolic functions.
Formula:C5H7NO3
InChI:InChI=1S/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/t3-/m0/s1
InChI key:InChIKey=ODHCTXKNWHHXJC-VKHMYHEASA-N
SMILES:C(O)(=O)[C@H]1NC(=O)CC1
Synonyms:- 5-Oxo-L-proline
- Proline, 5-oxo-, L-
- L-5-Carboxy-2-pyrrolidinone
- L-Pyroglutamic acid
- L-Proline, 5-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
L-Proline, 5-oxo-, 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl ester
CAS:Formula:C13H23NO7Molecular weight:305.32422

