CAS 95652-77-0

methyl 2-chloro-6-methoxypyridine-3-carboxylate

Description:

Methyl 2-chloro-6-methoxypyridine-3-carboxylate, with the CAS number 95652-77-0, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring substituted with a chlorine atom at the 2-position, a methoxy group at the 6-position, and a carboxylate group at the 3-position, with a methyl ester functional group. The presence of these functional groups contributes to its chemical reactivity and potential applications in organic synthesis and medicinal chemistry. The compound is typically characterized by its molecular structure, which influences its physical properties such as solubility, boiling point, and melting point. Methyl 2-chloro-6-methoxypyridine-3-carboxylate may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis often involves multi-step reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its identity and purity. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₈ClNO₃

InChI: InChI=1/C8H8ClNO3/c1-12-6-4-3-5(7(9)10-6)8(11)13-2/h3-4H,1-2H3

SMILES: COc1ccc(c(Cl)n1)C(=O)OC

Synonyms:

• 3-Pyridinecarboxylic Acid, 2-Chloro-6-Methoxy-, Methyl Ester

Methyl 2-chloro-6-methoxynicotinate

CAS: 95652-77-0

Formula: C₈H₈ClNO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 201.6070

Ref: IN-DA00H8NT

Methyl 2-chloro-6-methoxynicotinate

CAS: 95652-77-0

Methyl 2-chloro-6-methoxynicotinate

Purity: 97%

Color and Shape: Powder

Molecular weight: 201.61g/mol

Ref: 54-OR43596

Methyl 2-chloro-6-methoxynicotinate

CAS: 95652-77-0

Formula: C₈H₈ClNO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 201.61

Ref: 10-F323938