CymitQuimica logo

CAS 956534-58-0

:

5-Amino-1-methyl-1H-pyrazole-4-carbothioamide

Description:
5-Amino-1-methyl-1H-pyrazole-4-carbothioamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features an amino group and a methyl group at the 1-position, contributing to its basicity and potential reactivity. The presence of a carbothioamide functional group at the 4-position enhances its chemical properties, making it a candidate for various applications in medicinal chemistry and agrochemicals. The compound's structure suggests it may exhibit biological activity, potentially acting as an inhibitor or modulator in biochemical pathways. Its CAS number, 956534-58-0, allows for precise identification and retrieval of information regarding its properties, synthesis, and potential uses. As with many pyrazole derivatives, it may also possess interesting physical properties, such as solubility in organic solvents, which can be influenced by the substituents on the ring. Overall, 5-Amino-1-methyl-1H-pyrazole-4-carbothioamide represents a versatile scaffold for further chemical exploration and development.
Formula:C5H8N4S
InChI:InChI=1S/C5H8N4S/c1-9-4(6)3(2-8-9)5(7)10/h2H,6H2,1H3,(H2,7,10)
InChI key:InChIKey=IPUMHUUWBLQXFJ-UHFFFAOYSA-N
SMILES:C(N)(=S)C1=C(N)N(C)N=C1
Synonyms:
  • 5-Amino-1-methyl-1H-pyrazole-4-carbothioamide
  • 1H-Pyrazole-4-carbothioamide, 5-amino-1-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.