CAS 95656-51-2
:4-Amino-3-chloro-5-trifluoromethylbenzaldehyde
Description:
4-Amino-3-chloro-5-trifluoromethylbenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features an amino group (-NH2), a chloro substituent (-Cl), and a trifluoromethyl group (-CF3) attached to the benzene ring, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. The amino group can participate in hydrogen bonding, making the compound potentially useful in various chemical reactions, including nucleophilic substitutions. Additionally, the chlorinated and trifluoromethylated nature of the compound may impart specific electronic effects, affecting its stability and reactivity. This compound is of interest in pharmaceutical and agrochemical research due to its potential applications in drug development and as an intermediate in the synthesis of other complex molecules. Safety and handling precautions should be observed, as halogenated compounds can exhibit toxicity and environmental persistence.
Formula:C8H5ClF3NO
InChI:InChI=1/C8H5ClF3NO/c9-6-2-4(3-14)1-5(7(6)13)8(10,11)12/h1-3H,13H2
SMILES:c1c(cc(c(c1C(F)(F)F)N)Cl)C=O
Synonyms:- 4-Amino-3-Chloro-5-(Trifluoromethyl)Benzaldehyde
- Benzaldehyde, 4-amino-3-chloro-5-(trifluoromethyl)-
- Vhr Dz Cg Exfff
- 3-CHLORO -4-AMINO-5-TRIFLUOROMETHYL BENZALDEHYDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
