![1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[(2-methylbutan-2-yl)amino]ethanol](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F86348-1-4-amino-3-chloro-5-trifluoromethyl-phenyl-2-2-methylbutan-2-yl-amino-ethanol.webp&w=3840&q=75)
CAS 95656-68-1
:1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[(2-methylbutan-2-yl)amino]ethanol
Description:
1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[(2-methylbutan-2-yl)amino]ethanol, with the CAS number 95656-68-1, is a chemical compound characterized by its complex structure, which includes an amino group, a chloro substituent, and a trifluoromethyl group on a phenyl ring. This compound features a secondary amine linked to a branched alkyl chain, specifically 2-methylbutan-2-yl, which contributes to its steric properties. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The hydroxyl group in the ethanol moiety can participate in hydrogen bonding, potentially affecting solubility and reactivity. Overall, this compound's unique combination of functional groups suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies on its pharmacokinetics, toxicity, and specific applications would be necessary to fully understand its characteristics and potential uses.
Formula:C14H20ClF3N2O
InChI:InChI=1/C14H20ClF3N2O/c1-4-13(2,3)20-7-11(21)8-5-9(14(16,17)18)12(19)10(15)6-8/h5-6,11,20-21H,4,7,19H2,1-3H3
SMILES:CCC(C)(C)NCC(c1cc(c(c(c1)Cl)N)C(F)(F)F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
