CAS 956576-39-9
:2-Chloro-N-(4-chloro-2,5-dimethoxyphenyl)propanamide
Description:
2-Chloro-N-(4-chloro-2,5-dimethoxyphenyl)propanamide is a chemical compound characterized by its specific structural features, including a propanamide backbone and two chloro substituents on the aromatic ring. The presence of methoxy groups at the 2 and 5 positions of the phenyl ring contributes to its unique reactivity and solubility properties. This compound is typically classified as an amide, which indicates that it contains a carbonyl group (C=O) directly bonded to a nitrogen atom. The chloro substituents can enhance the compound's biological activity and influence its interaction with various biological targets. In terms of physical properties, it may exhibit moderate solubility in organic solvents and limited solubility in water, typical of many halogenated organic compounds. Its potential applications could span fields such as medicinal chemistry, where it may serve as a lead compound for drug development or as a research tool in studying specific biochemical pathways. Safety and handling precautions should be observed due to the presence of chlorine atoms, which can pose health risks.
Formula:C11H13Cl2NO3
InChI:InChI=1S/C11H13Cl2NO3/c1-6(12)11(15)14-8-5-9(16-2)7(13)4-10(8)17-3/h4-6H,1-3H3,(H,14,15)
InChI key:InChIKey=VXFFIAHQMRPYBQ-UHFFFAOYSA-N
SMILES:N(C(C(C)Cl)=O)C1=C(OC)C=C(Cl)C(OC)=C1
Synonyms:- Propanamide, 2-chloro-N-(4-chloro-2,5-dimethoxyphenyl)-
- 2-Chloro-N-(4-chloro-2,5-dimethoxyphenyl)propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.