CAS 956576-43-5
:2-[2-(1-Methylethoxy)phenyl]-4-quinolinecarboxylic acid hydrazide
Description:
2-[2-(1-Methylethoxy)phenyl]-4-quinolinecarboxylic acid hydrazide, identified by its CAS number 956576-43-5, is a chemical compound that features a quinoline core, which is a bicyclic structure known for its aromatic properties and biological activity. This compound contains a hydrazide functional group, which is characterized by the presence of a hydrazine moiety (-NH-NH2) linked to a carboxylic acid, enhancing its potential for reactivity and biological interactions. The presence of the 1-methylethoxy group contributes to its lipophilicity, potentially influencing its solubility and permeability in biological systems. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its characteristics and potential uses in therapeutic contexts.
Formula:C19H19N3O2
InChI:InChI=1S/C19H19N3O2/c1-12(2)24-18-10-6-4-8-14(18)17-11-15(19(23)22-20)13-7-3-5-9-16(13)21-17/h3-12H,20H2,1-2H3,(H,22,23)
InChI key:InChIKey=JVMHEDDVVCZSAS-UHFFFAOYSA-N
SMILES:C(NN)(=O)C=1C2=C(N=C(C1)C3=C(OC(C)C)C=CC=C3)C=CC=C2
Synonyms:- 2-[2-(1-Methylethoxy)phenyl]-4-quinolinecarboxylic acid hydrazide
- 4-Quinolinecarboxylic acid, 2-[2-(1-methylethoxy)phenyl]-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.