CAS 956576-44-6
:2-[4-(2-Methylpropoxy)phenyl]-4-quinolinecarboxylic acid hydrazide
Description:
2-[4-(2-Methylpropoxy)phenyl]-4-quinolinecarboxylic acid hydrazide, with the CAS number 956576-44-6, is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and quinoline derivatives, such as potential biological activity, including antimicrobial or anti-inflammatory effects. The presence of the 2-methylpropoxy group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The compound's hydrazide functional group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, its structural features may allow for interactions with biological targets, suggesting potential applications in pharmaceuticals or agrochemicals. As with many organic compounds, its stability, reactivity, and specific applications would depend on the surrounding conditions and the presence of other functional groups. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C20H21N3O2
InChI:InChI=1S/C20H21N3O2/c1-13(2)12-25-15-9-7-14(8-10-15)19-11-17(20(24)23-21)16-5-3-4-6-18(16)22-19/h3-11,13H,12,21H2,1-2H3,(H,23,24)
InChI key:InChIKey=YFOTXSRFOIERNW-UHFFFAOYSA-N
SMILES:C(NN)(=O)C=1C2=C(N=C(C1)C3=CC=C(OCC(C)C)C=C3)C=CC=C2
Synonyms:- 4-Quinolinecarboxylic acid, 2-[4-(2-methylpropoxy)phenyl]-, hydrazide
- 2-[4-(2-Methylpropoxy)phenyl]-4-quinolinecarboxylic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.