CymitQuimica logo

CAS 956576-45-7

:

2-(3-Bromophenyl)-4-quinolinecarboxylic acid hydrazide

Description:
2-(3-Bromophenyl)-4-quinolinecarboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a quinoline moiety and a hydrazide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the bromophenyl group may enhance its lipophilicity and influence its interaction with biological targets. As a hydrazide, it may participate in various chemical reactions, including hydrazone formation and potential coordination with metal ions. The compound is likely to be soluble in organic solvents, while its solubility in water may vary depending on pH and other factors. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological significance of both quinoline derivatives and hydrazides. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.
Formula:C16H12BrN3O
InChI:InChI=1S/C16H12BrN3O/c17-11-5-3-4-10(8-11)15-9-13(16(21)20-18)12-6-1-2-7-14(12)19-15/h1-9H,18H2,(H,20,21)
InChI key:InChIKey=QLYXLLUFCHPZOA-UHFFFAOYSA-N
SMILES:C(NN)(=O)C=1C2=C(N=C(C1)C3=CC(Br)=CC=C3)C=CC=C2
Synonyms:
  • 4-Quinolinecarboxylic acid, 2-(3-bromophenyl)-, hydrazide
  • 2-(3-Bromophenyl)-4-quinolinecarboxylic acid hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.