CAS 956576-46-8

2-(5-Ethyl-2-thienyl)-4-quinolinecarboxylic acid hydrazide

Description:

2-(5-Ethyl-2-thienyl)-4-quinolinecarboxylic acid hydrazide is a chemical compound characterized by its unique structure, which combines a quinoline moiety with a thienyl group and a hydrazide functional group. This compound typically exhibits properties such as moderate solubility in organic solvents, which may vary depending on the specific solvent and conditions. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of potential therapeutic agents. The presence of both the thienyl and quinoline rings suggests potential interactions with biological targets, possibly influencing its pharmacological profile. Additionally, the hydrazide functional group can participate in various chemical reactions, including hydrazone formation and coupling reactions, which may be useful in synthetic applications. Overall, this compound's characteristics, including its structural features and potential reactivity, make it a subject of interest in both organic chemistry and medicinal chemistry research.

Formula: C₁₆H₁₅N₃OS

InChI: InChI=1S/C16H15N3OS/c1-2-10-7-8-15(21-10)14-9-12(16(20)19-17)11-5-3-4-6-13(11)18-14/h3-9H,2,17H2,1H3,(H,19,20)

InChI key: InChIKey=ZWQYBAYZAOQRBX-UHFFFAOYSA-N

SMILES: C(NN)(=O)C=1C2=C(N=C(C1)C=3SC(CC)=CC3)C=CC=C2

Synonyms:

• 2-(5-Ethyl-2-thienyl)-4-quinolinecarboxylic acid hydrazide
• 4-Quinolinecarboxylic acid, 2-(5-ethyl-2-thienyl)-, hydrazide