CAS 956576-47-9
:6-(1,1-Dimethylethyl)benzo[b]thiophene-3-carboxylic acid hydrazide
Description:
6-(1,1-Dimethylethyl)benzo[b]thiophene-3-carboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene core substituted with a 1,1-dimethylethyl group and a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and thiophene derivatives, such as potential biological activity and solubility in organic solvents. The presence of the hydrazide moiety may contribute to its reactivity, particularly in forming hydrazones or participating in condensation reactions. Additionally, the bulky 1,1-dimethylethyl substituent can influence the compound's steric properties and stability. The compound's specific applications may vary, but it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally for precise characterization. Safety data and handling precautions should also be considered when working with this substance.
Formula:C13H16N2OS
InChI:InChI=1S/C13H16N2OS/c1-13(2,3)8-4-5-9-10(12(16)15-14)7-17-11(9)6-8/h4-7H,14H2,1-3H3,(H,15,16)
InChI key:InChIKey=WCCGEJGQEJPCFI-UHFFFAOYSA-N
SMILES:C(NN)(=O)C=1C=2C(=CC(C(C)(C)C)=CC2)SC1
Synonyms:- Benzo[b]thiophene-3-carboxylic acid, 6-(1,1-dimethylethyl)-, hydrazide
- 6-(1,1-Dimethylethyl)benzo[b]thiophene-3-carboxylic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.