CAS 956576-48-0
:6-Ethyl-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid hydrazide
Description:
6-Ethyl-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene core fused with a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and thiophene derivatives, such as potential biological activity and the ability to form hydrogen bonds due to the presence of the hydrazide moiety. The ethyl group contributes to its hydrophobic characteristics, which may influence its solubility and interaction with biological systems. Additionally, the tetrahydrobenzo[b]thiophene structure may impart stability and specific reactivity patterns, making it of interest in medicinal chemistry and drug development. The compound's hydrazide functionality can participate in various chemical reactions, including condensation and acylation, which are valuable in synthetic organic chemistry. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of new therapeutic agents.
Formula:C11H16N2OS
InChI:InChI=1S/C11H16N2OS/c1-2-7-3-4-8-9(11(14)13-12)6-15-10(8)5-7/h6-7H,2-5,12H2,1H3,(H,13,14)
InChI key:InChIKey=KCYUHNSKVLQILF-UHFFFAOYSA-N
SMILES:C(NN)(=O)C=1C2=C(CC(CC)CC2)SC1
Synonyms:- 6-Ethyl-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid hydrazide
- Benzo[b]thiophene-3-carboxylic acid, 6-ethyl-4,5,6,7-tetrahydro-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.