CAS 956576-49-1

6-Bromo-2-[4-(1-methylethyl)phenyl]-4-quinolinecarboxylic acid hydrazide

Description:

6-Bromo-2-[4-(1-methylethyl)phenyl]-4-quinolinecarboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes a quinoline ring system, a bromine substituent, and a hydrazide functional group. The presence of the bromine atom enhances its reactivity and potential biological activity, while the hydrazide moiety may contribute to its ability to form hydrogen bonds, influencing solubility and interaction with biological targets. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components that can interact with various biological systems. Additionally, the isopropyl group attached to the phenyl ring may enhance lipophilicity, affecting the compound's pharmacokinetic properties. Overall, this compound's unique combination of functional groups and structural features makes it a subject of interest for further research in drug development and related fields.

Formula: C₁₉H₁₈BrN₃O

InChI: InChI=1S/C19H18BrN3O/c1-11(2)12-3-5-13(6-4-12)18-10-16(19(24)23-21)15-9-14(20)7-8-17(15)22-18/h3-11H,21H2,1-2H3,(H,23,24)

InChI key: InChIKey=NREFDNBERMMWEE-UHFFFAOYSA-N

SMILES: C(NN)(=O)C=1C2=C(N=C(C1)C3=CC=C(C(C)C)C=C3)C=CC(Br)=C2

Synonyms:

• 4-Quinolinecarboxylic acid, 6-bromo-2-[4-(1-methylethyl)phenyl]-, hydrazide
• 6-Bromo-2-[4-(1-methylethyl)phenyl]-4-quinolinecarboxylic acid hydrazide
• 6-bromo-2-(4-propan-2-ylphenyl)quinoline-4-carbohydrazide
• 6-BROMO-2-(4-ISOPROPYLPHENYL)QUINOLINE-4-CARBOHYDRAZIDE