CymitQuimica logo

CAS 956576-51-5

:

3-Chloro-4-methylbenzo[b]thiophene-2-carboxylic acid hydrazide

Description:
3-Chloro-4-methylbenzo[b]thiophene-2-carboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene moiety, a carboxylic acid group, and a hydrazide functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both the hydrazide and carboxylic acid functionalities. The chlorine substituent and methyl group on the aromatic ring can influence its chemical behavior, including its reactivity and interaction with biological systems. Compounds of this nature may be of interest in medicinal chemistry, particularly for their potential biological activities, including antimicrobial or anti-inflammatory properties. Additionally, the presence of the thiophene ring may contribute to electronic properties that could be exploited in various applications, such as organic electronics or as intermediates in synthetic chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H9ClN2OS
InChI:InChI=1S/C10H9ClN2OS/c1-5-3-2-4-6-7(5)8(11)9(15-6)10(14)13-12/h2-4H,12H2,1H3,(H,13,14)
InChI key:InChIKey=ATGXTSRTLFBEHI-UHFFFAOYSA-N
SMILES:ClC=1C=2C(SC1C(NN)=O)=CC=CC2C
Synonyms:
  • Benzo[b]thiophene-2-carboxylic acid, 3-chloro-4-methyl-, hydrazide
  • 3-Chloro-4-methylbenzo[b]thiophene-2-carboxylic acid hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.