CAS 956576-53-7

6-Ethyl-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid hydrazide

Description:

6-Ethyl-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene core fused with a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and thiophene derivatives, such as potential biological activity and the ability to participate in various chemical reactions. The presence of the ethyl group contributes to its hydrophobic characteristics, while the carboxylic acid moiety can engage in hydrogen bonding and enhance solubility in polar solvents. The compound may also display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its CAS number, 956576-53-7, allows for easy identification and retrieval of information regarding its synthesis, applications, and safety data. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions and the presence of functional groups.

Formula: C₁₁H₁₆N₂OS

InChI: InChI=1S/C11H16N2OS/c1-2-7-3-4-8-6-10(11(14)13-12)15-9(8)5-7/h6-7H,2-5,12H2,1H3,(H,13,14)

InChI key: InChIKey=QESAJTHCEAJZJB-UHFFFAOYSA-N

SMILES: C(NN)(=O)C=1SC2=C(C1)CCC(CC)C2

Synonyms:

• 6-Ethyl-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid hydrazide
• Benzo[b]thiophene-2-carboxylic acid, 6-ethyl-4,5,6,7-tetrahydro-, hydrazide