CAS 956576-54-8

6-(1,1-Dimethylethyl)-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid hydrazide

Description:

6-(1,1-Dimethylethyl)-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene core fused with a hydrazide functional group. This compound features a tert-butyl group (1,1-dimethylethyl) that enhances its lipophilicity, potentially influencing its biological activity and solubility. The presence of the carboxylic acid moiety suggests that it may exhibit acidic properties, which can be relevant in various chemical reactions or biological interactions. The hydrazide functional group is known for its reactivity, particularly in forming hydrazones and participating in condensation reactions. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological properties, although specific biological activities would require further investigation. Its CAS number, 956576-54-8, allows for easy identification in chemical databases and literature. Overall, this compound's structural features suggest a potential for diverse applications in research and development within the fields of organic chemistry and pharmaceuticals.

Formula: C₁₃H₂₀N₂OS

InChI: InChI=1S/C13H20N2OS/c1-13(2,3)9-5-4-8-6-11(12(16)15-14)17-10(8)7-9/h6,9H,4-5,7,14H2,1-3H3,(H,15,16)

InChI key: InChIKey=SXQVIBXIOIDPAU-UHFFFAOYSA-N

SMILES: C(NN)(=O)C=1SC2=C(C1)CCC(C(C)(C)C)C2

Synonyms:

• Benzo[b]thiophene-2-carboxylic acid, 6-(1,1-dimethylethyl)-4,5,6,7-tetrahydro-, hydrazide
• 6-(1,1-Dimethylethyl)-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid hydrazide