CAS 956576-56-0

1-(5-Heptyl-2-furanyl)ethanone

Description:

1-(5-Heptyl-2-furanyl)ethanone is an organic compound characterized by its unique structure, which includes a furan ring and a heptyl side chain. The furan ring contributes to its aromatic properties, while the heptyl group enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound typically exhibits a pleasant, sweet, or fruity odor, making it of interest in flavor and fragrance applications. Its molecular structure suggests potential reactivity, particularly in electrophilic aromatic substitution reactions due to the electron-rich nature of the furan ring. Additionally, the presence of the ketone functional group (ethanone) indicates that it may participate in various chemical reactions, such as nucleophilic additions. The compound's physical properties, such as boiling point and melting point, would depend on its molecular weight and intermolecular forces. Overall, 1-(5-Heptyl-2-furanyl)ethanone is a compound of interest in organic synthesis and potential applications in the food and cosmetic industries.

Formula: C₁₃H₂₀O₂

InChI: InChI=1S/C13H20O2/c1-3-4-5-6-7-8-12-9-10-13(15-12)11(2)14/h9-10H,3-8H2,1-2H3

InChI key: InChIKey=GIWAUPSOMAQLLW-UHFFFAOYSA-N

SMILES: C(CCCCCC)C=1OC(C(C)=O)=CC1

Synonyms:

• Ethanone, 1-(5-heptyl-2-furanyl)-
• 1-(5-Heptyl-2-furanyl)ethanone