CAS 956576-72-0
:6-Fluoro-1,2,3,4-tetrahydro-1-[(4-isothiocyanatophenyl)sulfonyl]-2-methylquinoline
Description:
6-Fluoro-1,2,3,4-tetrahydro-1-[(4-isothiocyanatophenyl)sulfonyl]-2-methylquinoline is a synthetic organic compound characterized by its complex structure, which includes a quinoline core, a sulfonyl group, and an isothiocyanate moiety. The presence of the fluorine atom contributes to its electronic properties, potentially enhancing its reactivity and biological activity. The isothiocyanate group is known for its role in various biological activities, including anticancer properties, while the sulfonyl group can influence solubility and stability. This compound may exhibit significant pharmacological potential, making it of interest in medicinal chemistry and drug development. Its unique structural features suggest possible applications in targeting specific biological pathways or mechanisms. As with many synthetic compounds, the characteristics such as solubility, melting point, and reactivity would depend on the specific conditions under which the compound is studied. Further research would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C17H15FN2O2S2
InChI:InChI=1S/C17H15FN2O2S2/c1-12-2-3-13-10-14(18)4-9-17(13)20(12)24(21,22)16-7-5-15(6-8-16)19-11-23/h4-10,12H,2-3H2,1H3
InChI key:InChIKey=IWRWMQMJLHPEIJ-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(CCC1C)=CC(F)=CC2)C3=CC=C(N=C=S)C=C3
Synonyms:- Quinoline, 6-fluoro-1,2,3,4-tetrahydro-1-[(4-isothiocyanatophenyl)sulfonyl]-2-methyl-
- 6-Fluoro-1,2,3,4-tetrahydro-1-[(4-isothiocyanatophenyl)sulfonyl]-2-methylquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.