CAS 956576-75-3

1,2,3,4-Tetrahydro-1-[(4-isothiocyanatophenyl)sulfonyl]-2-methylquinoline

Description:

1,2,3,4-Tetrahydro-1-[(4-isothiocyanatophenyl)sulfonyl]-2-methylquinoline is a chemical compound characterized by its complex structure, which includes a quinoline core fused with a tetrahydro moiety. The presence of a sulfonyl group and an isothiocyanate substituent on the phenyl ring contributes to its reactivity and potential biological activity. This compound is likely to exhibit properties typical of quinoline derivatives, such as antimicrobial or anticancer activities, due to the presence of the isothiocyanate group, which is known for its ability to interact with biological targets. The sulfonyl group may enhance solubility and stability in various solvents. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Its specific applications and biological effects would depend on further studies, including pharmacological evaluations and toxicity assessments. Overall, this compound represents a class of heterocyclic compounds with potential significance in medicinal chemistry and drug development.

Formula: C₁₇H₁₆N₂O₂S₂

InChI: InChI=1S/C17H16N2O2S2/c1-13-6-7-14-4-2-3-5-17(14)19(13)23(20,21)16-10-8-15(9-11-16)18-12-22/h2-5,8-11,13H,6-7H2,1H3

InChI key: InChIKey=TUEPVZRQWTUJEB-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C=2C(CCC1C)=CC=CC2)C3=CC=C(N=C=S)C=C3

Synonyms:

• 1,2,3,4-Tetrahydro-1-[(4-isothiocyanatophenyl)sulfonyl]-2-methylquinoline
• Quinoline, 1,2,3,4-tetrahydro-1-[(4-isothiocyanatophenyl)sulfonyl]-2-methyl-