CymitQuimica logo

CAS 956576-78-6

:

2-Ethyl-1-[(4-isothiocyanatophenyl)sulfonyl]piperidine

Description:
2-Ethyl-1-[(4-isothiocyanatophenyl)sulfonyl]piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring substituted with an ethyl group and a sulfonyl moiety linked to a phenyl ring that carries an isothiocyanate functional group. This compound is typically classified as an organic sulfonamide and may exhibit properties such as moderate solubility in organic solvents, depending on the specific conditions. The presence of the isothiocyanate group suggests potential reactivity, particularly in nucleophilic addition reactions, making it of interest in medicinal chemistry and material science. Additionally, the sulfonyl group can enhance the compound's stability and influence its biological activity. As with many chemical substances, safety precautions should be observed when handling this compound, as isothiocyanates can be irritants. Overall, 2-Ethyl-1-[(4-isothiocyanatophenyl)sulfonyl]piperidine represents a versatile structure with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C14H18N2O2S2
InChI:InChI=1S/C14H18N2O2S2/c1-2-13-5-3-4-10-16(13)20(17,18)14-8-6-12(7-9-14)15-11-19/h6-9,13H,2-5,10H2,1H3
InChI key:InChIKey=BBEKMHRPEGEBBA-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C(CC)CCCC1)C2=CC=C(N=C=S)C=C2
Synonyms:
  • 2-Ethyl-1-[(4-isothiocyanatophenyl)sulfonyl]piperidine
  • Piperidine, 2-ethyl-1-[(4-isothiocyanatophenyl)sulfonyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.