CymitQuimica logo

CAS 956576-84-4

:

4-Ethyl-2,4-dihydro-5-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thien-3-yl)-3H-1,2,4-triazole-3-thione

Description:
4-Ethyl-2,4-dihydro-5-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thien-3-yl)-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its complex structure, which includes a triazole ring and a thione functional group. The presence of the ethyl group and the tetrahydro-cycloheptathiene moiety contributes to its unique properties. This compound is likely to exhibit biological activity, potentially serving as a pharmaceutical agent or a research chemical. Its thione group may impart specific reactivity, making it of interest in various chemical reactions or applications. The compound's molecular structure suggests it may have specific interactions with biological targets, which could be explored in medicinal chemistry. Additionally, its solubility, stability, and reactivity would depend on the surrounding conditions, such as pH and solvent. Overall, 4-Ethyl-2,4-dihydro-5-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thien-3-yl)-3H-1,2,4-triazole-3-thione represents a fascinating subject for further study in both synthetic and medicinal chemistry contexts.
Formula:C13H17N3S2
InChI:InChI=1S/C13H17N3S2/c1-2-16-12(14-15-13(16)17)10-8-18-11-7-5-3-4-6-9(10)11/h8H,2-7H2,1H3,(H,15,17)
InChI key:InChIKey=FJICFWKVWQVMST-UHFFFAOYSA-N
SMILES:C(C)N1C(C=2C3=C(SC2)CCCCC3)=NNC1=S
Synonyms:
  • 3H-1,2,4-Triazole-3-thione, 4-ethyl-2,4-dihydro-5-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thien-3-yl)-
  • 4-Ethyl-2,4-dihydro-5-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thien-3-yl)-3H-1,2,4-triazole-3-thione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.