CymitQuimica logo

CAS 956576-85-5

:

2,4-Dihydro-4-(2-propen-1-yl)-5-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thien-3-yl)-3H-1,2,4-triazole-3-thione

Description:
2,4-Dihydro-4-(2-propen-1-yl)-5-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thien-3-yl)-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its complex structure, which includes a triazole ring and a thione functional group. This compound features a tetrahydro-cycloheptathiene moiety, contributing to its unique properties and potential biological activity. The presence of the propenyl group suggests reactivity that may be exploited in various chemical reactions, including polymerization or as a building block in organic synthesis. Its thione group may impart specific interactions in biological systems, potentially influencing its pharmacological profile. The compound's molecular structure indicates it may exhibit interesting properties such as antimicrobial or antifungal activity, although specific biological data would be necessary to confirm these effects. As with many synthetic organic compounds, safety and handling precautions should be observed, and its stability under various conditions should be evaluated for practical applications. Further research could elucidate its potential uses in pharmaceuticals or agrochemicals.
Formula:C14H17N3S2
InChI:InChI=1S/C14H17N3S2/c1-2-8-17-13(15-16-14(17)18)11-9-19-12-7-5-3-4-6-10(11)12/h2,9H,1,3-8H2,(H,16,18)
InChI key:InChIKey=QVBYKDHQMHWPQW-UHFFFAOYSA-N
SMILES:C(C=C)N1C(C=2C3=C(SC2)CCCCC3)=NNC1=S
Synonyms:
  • 2,4-Dihydro-4-(2-propen-1-yl)-5-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thien-3-yl)-3H-1,2,4-triazole-3-thione
  • 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-4-(2-propen-1-yl)-5-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thien-3-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.