CAS 956605-16-6

1,1-Dimethylethyl 3,4-dihydro-7-methyl-4-oxospiro[2H-1-benzopyran-2,4′-piperidine]-1′-carboxylate

Description:

1,1-Dimethylethyl 3,4-dihydro-7-methyl-4-oxospiro[2H-1-benzopyran-2,4′-piperidine]-1′-carboxylate, with CAS number 956605-16-6, is a complex organic compound characterized by its spirocyclic structure, which incorporates both a benzopyran and a piperidine moiety. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the dimethyl group enhances its steric bulk, which may influence its biological activity and interactions with other molecules. The compound is likely to exhibit unique pharmacological properties due to its structural features, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would typically involve advanced organic synthesis techniques, and it may be evaluated for various applications, including as a potential therapeutic agent. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species.

Formula: C₁₉H₂₅NO₄

InChI: InChI=1S/C19H25NO4/c1-13-5-6-14-15(21)12-19(23-16(14)11-13)7-9-20(10-8-19)17(22)24-18(2,3)4/h5-6,11H,7-10,12H2,1-4H3

InChI key: InChIKey=SWOGQOUWYXAHQK-UHFFFAOYSA-N

SMILES: O=C1CC2(OC=3C1=CC=C(C)C3)CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• Spiro[2H-1-benzopyran-2,4′-piperidine]-1′-carboxylic acid, 3,4-dihydro-7-methyl-4-oxo-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3,4-dihydro-7-methyl-4-oxospiro[2H-1-benzopyran-2,4′-piperidine]-1′-carboxylate