CAS 956699-06-2
:rel-6-[(2R,6S)-2,6-Dimethyl-4-morpholinyl]-3-pyridinamine
Description:
Rel-6-[(2R,6S)-2,6-Dimethyl-4-morpholinyl]-3-pyridinamine, identified by its CAS number 956699-06-2, is a chemical compound characterized by its specific molecular structure, which includes a pyridine ring and a morpholine moiety. This compound typically exhibits properties associated with amines and heterocycles, such as basicity and potential for hydrogen bonding due to the presence of nitrogen atoms. The stereochemistry indicated by the (2R,6S) configuration suggests that it has chiral centers, which can influence its biological activity and interactions with other molecules. Such compounds are often studied for their pharmacological properties, particularly in the context of drug development, where their ability to interact with biological targets can be crucial. Additionally, the presence of dimethyl groups may enhance lipophilicity, affecting the compound's solubility and permeability. Overall, rel-6-[(2R,6S)-2,6-Dimethyl-4-morpholinyl]-3-pyridinamine represents a class of compounds with potential applications in medicinal chemistry and pharmacology.
Formula:C11H17N3O
InChI:InChI=1/C11H17N3O/c1-8-6-14(7-9(2)15-8)11-4-3-10(12)5-13-11/h3-5,8-9H,6-7,12H2,1-2H3/t8-,9+
InChI key:InChIKey=VLPBNQMPKNGOJC-DTORHVGONA-N
SMILES:C[C@H]1CN(C[C@@H](C)O1)C2=CC=C(N)C=N2
Synonyms:- rel-6-[(2R,6S)-2,6-Dimethyl-4-morpholinyl]-3-pyridinamine
- 3-Pyridinamine, 6-[(2R,6S)-2,6-dimethyl-4-morpholinyl]-, rel-
- 6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine
- 956699-06-2
- 6-((2R,6S)-2,6-dimethylmorpholino)pyridin-3-amine
- rel-6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine
- rel-6-((2R,6S)-2,6-Dimethylmorpholino)pyridin-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.