CAS 956722-46-6

1-[(4-Methoxyphenyl)methyl]-3-piperidinamine

Description:

1-[(4-Methoxyphenyl)methyl]-3-piperidinamine, identified by its CAS number 956722-46-6, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a methoxyphenyl group attached to a methyl group, contributing to its structural complexity and potential biological activity. The presence of the methoxy group enhances lipophilicity, which may influence its pharmacokinetic properties. As a piperidinamine derivative, it may exhibit various interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in drug development, particularly in areas related to neuropharmacology or as a scaffold for synthesizing other bioactive molecules. However, specific data regarding its solubility, stability, and reactivity would require further investigation through experimental studies. Overall, this compound represents a class of organic molecules that may hold promise in therapeutic applications, pending further research into its efficacy and safety profiles.

Formula: C₁₃H₂₀N₂O

InChI: InChI=1S/C13H20N2O/c1-16-13-6-4-11(5-7-13)9-15-8-2-3-12(14)10-15/h4-7,12H,2-3,8-10,14H2,1H3

InChI key: InChIKey=LBMGSIVSAWHALC-UHFFFAOYSA-N

SMILES: C(C1=CC=C(OC)C=C1)N2CC(N)CCC2

Synonyms:

• 3-Piperidinamine, 1-[(4-methoxyphenyl)methyl]-
• 1-[(4-Methoxyphenyl)methyl]-3-piperidinamine
• 1-(4-Methoxybenzyl)piperidin-3-amine