CAS 956729-47-8

1-benzyl-5-methyl-1H-pyrazol-3-amine

Description:

1-Benzyl-5-methyl-1H-pyrazol-3-amine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a benzyl group attached to the first position of the pyrazole, contributing to its aromatic properties, while a methyl group is located at the fifth position. The presence of an amino group at the third position enhances its reactivity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions and applications. Typically, compounds like this may exhibit biological activity, potentially serving as intermediates in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests it may participate in interactions with biological targets, which could be explored in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 1-benzyl-5-methyl-1H-pyrazol-3-amine represents a versatile structure in organic synthesis and medicinal chemistry.

Formula: C₁₁H₁₃N₃

InChI: InChI=1/C11H13N3/c1-9-7-11(12)13-14(9)8-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H2,12,13)

SMILES: Cc1cc(=N)[nH]n1Cc1ccccc1

Synonyms:

• 1H-Pyrazol-3-amine, 5-methyl-1-(phenylmethyl)-
• 1-Benzyl-5-methyl-1H-pyrazol-3-amine