CAS 956754-20-4

α-Hydroxy-5-methyl-2-furanacetic acid

Description:

α-Hydroxy-5-methyl-2-furanacetic acid, identified by its CAS number 956754-20-4, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a hydroxyl group (-OH) and a carboxylic acid group (-COOH), contributing to its acidic properties and potential for hydrogen bonding. The presence of the methyl group enhances its hydrophobic characteristics, influencing its solubility and reactivity. α-Hydroxy-5-methyl-2-furanacetic acid is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activities. Its structural features may allow it to participate in various chemical reactions, such as esterification or oxidation, making it a versatile compound in synthetic organic chemistry. Additionally, the furan moiety can be involved in further functionalization, expanding its utility in chemical synthesis. Overall, this compound exemplifies the intersection of structural complexity and functional diversity in organic chemistry.

Formula: C₇H₈O₄

InChI: InChI=1S/C7H8O4/c1-4-2-3-5(11-4)6(8)7(9)10/h2-3,6,8H,1H3,(H,9,10)

InChI key: InChIKey=FGNOKZZROZEXBK-UHFFFAOYSA-N

SMILES: C(C(O)=O)(O)C1=CC=C(C)O1

Synonyms:

• α-Hydroxy-5-methyl-2-furanacetic acid
• 2-Furanacetic acid, α-hydroxy-5-methyl-
• 2-Hydroxy-2-(5-methylfuran-2-yl)acetic acid