CAS 956804-32-3

1-[3-(3,5-dimethyl-1H-pyrazol-1-yl)phenyl]-N-methylmethanamine

Description:

1-[3-(3,5-dimethyl-1H-pyrazol-1-yl)phenyl]-N-methylmethanamine, with the CAS number 956804-32-3, is a chemical compound characterized by its unique molecular structure, which includes a pyrazole ring and an amine functional group. This compound typically exhibits properties associated with organic amines, such as basicity and the ability to form hydrogen bonds. The presence of the pyrazole moiety may impart specific biological activities, making it of interest in pharmaceutical research. The compound is likely to be soluble in organic solvents, and its solubility in water may vary depending on the pH and the presence of other functional groups. Additionally, the presence of methyl groups on the pyrazole ring can influence its steric and electronic properties, potentially affecting its reactivity and interaction with biological targets. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and related fields, where it may be explored for various applications, including drug development.

Formula: C₁₃H₁₇N₃

InChI: InChI=1/C13H17N3/c1-10-7-11(2)16(15-10)13-6-4-5-12(8-13)9-14-3/h4-8,14H,9H2,1-3H3

SMILES: Cc1cc(C)n(c2cccc(c2)CNC)n1

1-[3-(3,5-Dimethyl-1h-pyrazol-1-yl)phenyl]-n-methylmethanamine

CAS: 956804-32-3

Formula: C₁₃H₁₇N₃

Molecular weight: 215.2942

Ref: IN-DA005Z0J

1-[3-(3,5-dimethyl-1H-pyrazol-1-yl)phenyl]-N-methylmethanamine

CAS: 956804-32-3

Formula: C₁₃H₁₇N₃

Purity: 95.0%

Molecular weight: 215.3

Ref: 10-F308762