CAS 956824-00-3

1′-Ethyl-1-(4-fluorophenyl)-3′-methyl[3,4′-bi-1H-pyrazole]-4-carboxylic acid

Description:

1′-Ethyl-1-(4-fluorophenyl)-3′-methyl[3,4′-bi-1H-pyrazole]-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a bi-pyrazole framework and various functional groups. The presence of an ethyl group and a 4-fluorophenyl moiety contributes to its unique chemical properties and potential biological activity. This compound features a carboxylic acid functional group, which can participate in hydrogen bonding and influence its solubility and reactivity. The fluorine atom in the phenyl ring may enhance lipophilicity and affect the compound's interaction with biological targets. Additionally, the methyl group at the 3′ position of the pyrazole ring can influence steric hindrance and electronic properties. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific applications and behavior would depend on further studies, including its synthesis, stability, and interactions with biological systems.

Formula: C₁₆H₁₅FN₄O₂

InChI: InChI=1S/C16H15FN4O2/c1-3-20-8-13(10(2)18-20)15-14(16(22)23)9-21(19-15)12-6-4-11(17)5-7-12/h4-9H,3H2,1-2H3,(H,22,23)

InChI key: InChIKey=JUYPSWYUJCLWSK-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=NN(C1)C2=CC=C(F)C=C2)C3=CN(CC)N=C3C

Synonyms:

• 1′-Ethyl-1-(4-fluorophenyl)-3′-methyl[3,4′-bi-1H-pyrazole]-4-carboxylic acid
• [3,4′-Bi-1H-pyrazole]-4-carboxylic acid, 1′-ethyl-1-(4-fluorophenyl)-3′-methyl-

3-(1-Ethyl-3-methyl-1H-pyrazol-4-yl)-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylic acid

CAS: 956824-00-3

Versatile small molecule scaffold

Formula: C₁₆H₁₅FN₄O₂

Purity: Min. 95%

Molecular weight: 314.31 g/mol

Ref: 3D-GNB82400