CAS 956935-28-7

1-Ethyl-3,5-dimethyl-1H-pyrazole-4-acetic acid

Description:

1-Ethyl-3,5-dimethyl-1H-pyrazole-4-acetic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an ethyl group and two methyl groups attached to the pyrazole ring, contributing to its unique properties. The presence of the acetic acid functional group indicates that it has acidic characteristics, which may influence its solubility and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical and agricultural research. The molecular structure allows for potential interactions with various biological targets, and its specific substituents can affect its pharmacokinetic and pharmacodynamic profiles. Additionally, the compound's stability, solubility in different solvents, and reactivity with other chemicals can vary based on environmental conditions. Overall, 1-Ethyl-3,5-dimethyl-1H-pyrazole-4-acetic acid represents a class of compounds that may have significant applications in medicinal chemistry and agrochemicals.

Formula: C₉H₁₄N₂O₂

InChI: InChI=1S/C9H14N2O2/c1-4-11-7(3)8(5-9(12)13)6(2)10-11/h4-5H2,1-3H3,(H,12,13)

InChI key: InChIKey=UYGRRTZTDSPSJM-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=C(C)N(CC)N=C1C

Synonyms:

• 1-Ethyl-3,5-dimethyl-1H-pyrazole-4-acetic acid
• 1H-Pyrazole-4-acetic acid, 1-ethyl-3,5-dimethyl-

2-(1-Ethyl-3,5-dimethyl-1H-pyrazol-4-yl)acetic acid

CAS: 956935-28-7

Versatile small molecule scaffold

Formula: C₉H₁₄N₂O₂

Purity: Min. 95%

Molecular weight: 182.22 g/mol

Ref: 3D-GNB93528