CAS 956935-30-1

1-[[1-(Difluoromethyl)-3,5-dimethyl-1H-pyrazol-4-yl]sulfonyl]-3-piperidinecarboxylic acid

Description:

1-[[1-(Difluoromethyl)-3,5-dimethyl-1H-pyrazol-4-yl]sulfonyl]-3-piperidinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazole ring and a piperidine moiety. The presence of a difluoromethyl group contributes to its unique reactivity and potential biological activity. The sulfonyl group enhances its solubility and may play a role in its interaction with biological targets. This compound is likely to exhibit properties typical of both heterocyclic and carboxylic acid functionalities, which can influence its pharmacological profile. It may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential as a bioactive agent. The specific arrangement of substituents on the pyrazole and piperidine rings can affect its binding affinity and selectivity for various biological receptors or enzymes. Overall, this compound represents a class of molecules that could be explored for therapeutic applications, pending further investigation into its efficacy and safety profiles.

Formula: C₁₂H₁₇F₂N₃O₄S

InChI: InChI=1S/C12H17F2N3O4S/c1-7-10(8(2)17(15-7)12(13)14)22(20,21)16-5-3-4-9(6-16)11(18)19/h9,12H,3-6H2,1-2H3,(H,18,19)

InChI key: InChIKey=NNZWLENXMIIWJE-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=C(C)N(C(F)F)N=C1C)N2CC(C(O)=O)CCC2

Synonyms:

• 3-Piperidinecarboxylic acid, 1-[[1-(difluoromethyl)-3,5-dimethyl-1H-pyrazol-4-yl]sulfonyl]-
• 1-[[1-(Difluoromethyl)-3,5-dimethyl-1H-pyrazol-4-yl]sulfonyl]-3-piperidinecarboxylic acid

1-{[1-(Difluoromethyl)-3,5-dimethyl-1H-pyrazol-4-yl]sulfonyl}piperidine-3-carboxylic acid

CAS: 956935-30-1

Versatile small molecule scaffold

Formula: C₁₂H₁₇F₂N₃O₄S

Purity: Min. 95%

Molecular weight: 337.35 g/mol

Ref: 3D-GNB93530