CAS 956935-38-9

N,1-Diethyl-5-methyl-1H-pyrazole-4-methanamine

Description:

N,1-Diethyl-5-methyl-1H-pyrazole-4-methanamine is a chemical compound characterized by its unique pyrazole structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features two ethyl groups and a methyl group attached to the pyrazole ring, along with a methanamine functional group, contributing to its overall reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine group. The presence of multiple functional groups suggests that it could participate in various chemical reactions, making it of interest in medicinal chemistry and material science. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is studied. As with many nitrogen-containing heterocycles, it may also exhibit biological activity, warranting further investigation into its potential uses in pharmaceuticals or agrochemicals.

Formula: C₉H₁₇N₃

InChI: InChI=1S/C9H17N3/c1-4-10-6-9-7-11-12(5-2)8(9)3/h7,10H,4-6H2,1-3H3

InChI key: InChIKey=OHGSEVDQYHENGZ-UHFFFAOYSA-N

SMILES: C(NCC)C1=C(C)N(CC)N=C1

Synonyms:

• N,1-Diethyl-5-methyl-1H-pyrazole-4-methanamine
• 1H-Pyrazole-4-methanamine, N,1-diethyl-5-methyl-